C19H24N4O2S — CID 16868499
N-[4-(dimethylamino)phenyl]-2-(5-oxo-7-propyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)acetamide (PubChem CID 16868499) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-(5-oxo-7-propyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)acetamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-(5-oxo-7-propyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 16868499 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-(5-oxo-7-propyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)acetamide |
| SMILES | CCCc1cc(=O)n2c(n1)SCC2CC(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H24N4O2S/c1-4-5-14-10-18(25)23-16(12-26-19(23)21-14)11-17(24)20-13-6-8-15(9-7-13)22(2)3/h6-10,16H,4-5,11-12H2,1-3H3,(H,20,24) |
| InChIKey | JBVYYIQXMCZHJW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|