C8H10N4OS — CID 168685142
4-ethenyl-1-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)pyrrolidin-2-one (PubChem CID 168685142) has the molecular formula C8H10N4OS and a molecular weight of 210.26 g/mol. Its IUPAC name is 4-ethenyl-1-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)pyrrolidin-2-one.
| Compound Name | 4-ethenyl-1-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168685142 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 4-ethenyl-1-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)pyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2nc(=S)[nH][nH]2)C1 |
| InChI | InChI=1S/C8H10N4OS/c1-2-5-3-6(13)12(4-5)7-9-8(14)11-10-7/h2,5H,1,3-4H2,(H2,9,10,11,14) |
| InChIKey | QQZGCPBTDJRFMC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|