C18H23NO — CID 168685186
4-ethenyl-1-[(1-phenylcyclopentyl)methyl]pyrrolidin-2-one (PubChem CID 168685186) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is 4-ethenyl-1-[(1-phenylcyclopentyl)methyl]pyrrolidin-2-one.
| Compound Name | 4-ethenyl-1-[(1-phenylcyclopentyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168685186 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 4-ethenyl-1-[(1-phenylcyclopentyl)methyl]pyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(CC2(c3ccccc3)CCCC2)C1 |
| InChI | InChI=1S/C18H23NO/c1-2-15-12-17(20)19(13-15)14-18(10-6-7-11-18)16-8-4-3-5-9-16/h2-5,8-9,15H,1,6-7,10-14H2 |
| InChIKey | QMFXOEPOBJNDMK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|