C10H13N3O — CID 168685510
4-ethenyl-1-(1H-imidazol-2-ylmethyl)pyrrolidin-2-one (PubChem CID 168685510) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-ethenyl-1-(1H-imidazol-2-ylmethyl)pyrrolidin-2-one.
| Compound Name | 4-ethenyl-1-(1H-imidazol-2-ylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168685510 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-ethenyl-1-(1H-imidazol-2-ylmethyl)pyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(Cc2ncc[nH]2)C1 |
| InChI | InChI=1S/C10H13N3O/c1-2-8-5-10(14)13(6-8)7-9-11-3-4-12-9/h2-4,8H,1,5-7H2,(H,11,12) |
| InChIKey | ZXIYLLONTGFFMS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|