C14H11N3O — CID 168685791
4-(4-ethenyl-2-oxopyrrolidin-1-yl)benzene-1,2-dicarbonitrile (PubChem CID 168685791) has the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. Its IUPAC name is 4-(4-ethenyl-2-oxopyrrolidin-1-yl)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(4-ethenyl-2-oxopyrrolidin-1-yl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 168685791 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-(4-ethenyl-2-oxopyrrolidin-1-yl)benzene-1,2-dicarbonitrile |
| SMILES | C=CC1CC(=O)N(c2ccc(C#N)c(C#N)c2)C1 |
| InChI | InChI=1S/C14H11N3O/c1-2-10-5-14(18)17(9-10)13-4-3-11(7-15)12(6-13)8-16/h2-4,6,10H,1,5,9H2 |
| InChIKey | LTCBEYUSTNEUFR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|