C9H11N5OS — CID 168686632
1-(6-amino-4-sulfanylidene-1H-1,3,5-triazin-2-yl)-4-ethenylpyrrolidin-2-one (PubChem CID 168686632) has the molecular formula C9H11N5OS and a molecular weight of 237.29 g/mol. Its IUPAC name is 1-(6-amino-4-sulfanylidene-1H-1,3,5-triazin-2-yl)-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-(6-amino-4-sulfanylidene-1H-1,3,5-triazin-2-yl)-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168686632 |
| Molecular Formula | C9H11N5OS |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 1-(6-amino-4-sulfanylidene-1H-1,3,5-triazin-2-yl)-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2nc(=S)nc(N)[nH]2)C1 |
| InChI | InChI=1S/C9H11N5OS/c1-2-5-3-6(15)14(4-5)8-11-7(10)12-9(16)13-8/h2,5H,1,3-4H2,(H3,10,11,12,13,16) |
| InChIKey | HYJSCKAQCXRVNW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|