About 1-[3-(aminomethyl)-3,5,5-trimethylcyclohexyl]-4-chloropyrrolidin-2-one
1-[3-(aminomethyl)-3,5,5-trimethylcyclohexyl]-4-chloropyrrolidin-2-one (PubChem CID 168686759) has the molecular formula C14H25ClN2O
and a molecular weight of 272.82 g/mol. Its IUPAC name is 1-[3-(aminomethyl)-3,5,5-trimethylcyclohexyl]-4-chloropyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[3-(aminomethyl)-3,5,5-trimethylcyclohexyl]-4-chloropyrrolidin-2-one |
| PubChem CID | 168686759 |
| Molecular Formula | C14H25ClN2O |
| Molecular Weight | 272.82 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 1-[3-(aminomethyl)-3,5,5-trimethylcyclohexyl]-4-chloropyrrolidin-2-one |
| SMILES | CC1(C)CC(N2CC(Cl)CC2=O)CC(C)(CN)C1 |
| InChI | InChI=1S/C14H25ClN2O/c1-13(2)5-11(6-14(3,8-13)9-16)17-7-10(15)4-12(17)18/h10-11H,4-9,16H2,1-3H3 |
| InChIKey | KRVVKXAACPXRCU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.82 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(aminomethyl)-3,5,5-trimethylcyclohexyl]-4-chloropyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(aminomethyl)-3,5,5-trimethylcyclohexyl]-4-chloropyrrolidin-2-one?
The IUPAC name of 1-[3-(aminomethyl)-3,5,5-trimethylcyclohexyl]-4-chloropyrrolidin-2-one (CID 168686759) is 1-[3-(aminomethyl)-3,5,5-trimethylcyclohexyl]-4-chloropyrrolidin-2-one.
What is the SMILES notation for 1-[3-(aminomethyl)-3,5,5-trimethylcyclohexyl]-4-chloropyrrolidin-2-one?
The canonical SMILES for 1-[3-(aminomethyl)-3,5,5-trimethylcyclohexyl]-4-chloropyrrolidin-2-one is CC1(C)CC(N2CC(Cl)CC2=O)CC(C)(CN)C1.
What is the InChIKey of 1-[3-(aminomethyl)-3,5,5-trimethylcyclohexyl]-4-chloropyrrolidin-2-one?
The InChIKey is KRVVKXAACPXRCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25ClN2O/c1-13(2)5-11(6-14(3,8-13)9-16)17-7-10(15)4-12(17)18/h10-11H,4-9,16H2,1-3H3.
What are the key properties of 1-[3-(aminomethyl)-3,5,5-trimethylcyclohexyl]-4-chloropyrrolidin-2-one?
1-[3-(aminomethyl)-3,5,5-trimethylcyclohexyl]-4-chloropyrrolidin-2-one has a molecular weight of 272.82 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(aminomethyl)-3,5,5-trimethylcyclohexyl]-4-chloropyrrolidin-2-one is sourced from PubChem (CID 168686759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).