C11H13ClN2O — CID 168686908
4-chloro-1-(1-pyridin-3-ylethyl)pyrrolidin-2-one (PubChem CID 168686908) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is 4-chloro-1-(1-pyridin-3-ylethyl)pyrrolidin-2-one.
| Compound Name | 4-chloro-1-(1-pyridin-3-ylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168686908 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 4-chloro-1-(1-pyridin-3-ylethyl)pyrrolidin-2-one |
| SMILES | CC(c1cccnc1)N1CC(Cl)CC1=O |
| InChI | InChI=1S/C11H13ClN2O/c1-8(9-3-2-4-13-6-9)14-7-10(12)5-11(14)15/h2-4,6,8,10H,5,7H2,1H3 |
| InChIKey | RGKCHZLJTIXEDM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|