C13H18F3NO3 — CID 168691313
5-oxo-1-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrrolidine-3-carboxylic acid (PubChem CID 168691313) has the molecular formula C13H18F3NO3 and a molecular weight of 293.29 g/mol. Its IUPAC name is 5-oxo-1-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 5-oxo-1-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168691313 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 5-oxo-1-[[4-(trifluoromethyl)cyclohexyl]methyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CC(=O)N(CC2CCC(C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C13H18F3NO3/c14-13(15,16)10-3-1-8(2-4-10)6-17-7-9(12(19)20)5-11(17)18/h8-10H,1-7H2,(H,19,20) |
| InChIKey | IPDRPWWIPDFGRE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |