C14H17NO4 — CID 168692598
methyl 1-[2-(1-hydroxyethyl)phenyl]-5-oxopyrrolidine-3-carboxylate (PubChem CID 168692598) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl 1-[2-(1-hydroxyethyl)phenyl]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-[2-(1-hydroxyethyl)phenyl]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168692598 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl 1-[2-(1-hydroxyethyl)phenyl]-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(c2ccccc2C(C)O)C1 |
| InChI | InChI=1S/C14H17NO4/c1-9(16)11-5-3-4-6-12(11)15-8-10(7-13(15)17)14(18)19-2/h3-6,9-10,16H,7-8H2,1-2H3 |
| InChIKey | GXUHQMOYIZDCAU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |