C13H14FNO4 — CID 168693467
methyl 1-(5-fluoro-2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 168693467) has the molecular formula C13H14FNO4 and a molecular weight of 267.26 g/mol. Its IUPAC name is methyl 1-(5-fluoro-2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(5-fluoro-2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168693467 |
| Molecular Formula | C13H14FNO4 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | methyl 1-(5-fluoro-2-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(c2cc(F)ccc2OC)C1 |
| InChI | InChI=1S/C13H14FNO4/c1-18-11-4-3-9(14)6-10(11)15-7-8(5-12(15)16)13(17)19-2/h3-4,6,8H,5,7H2,1-2H3 |
| InChIKey | NUJVREUTJGSLQS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |