C12H13BrN2O4 — CID 168693487
methyl 1-(6-bromo-2-methoxy-3-pyridinyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 168693487) has the molecular formula C12H13BrN2O4 and a molecular weight of 329.15 g/mol. Its IUPAC name is methyl 1-(6-bromo-2-methoxy-3-pyridinyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(6-bromo-2-methoxy-3-pyridinyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168693487 |
| Molecular Formula | C12H13BrN2O4 |
| Molecular Weight | 329.15 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | methyl 1-(6-bromo-2-methoxy-3-pyridinyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(c2ccc(Br)nc2OC)C1 |
| InChI | InChI=1S/C12H13BrN2O4/c1-18-11-8(3-4-9(13)14-11)15-6-7(5-10(15)16)12(17)19-2/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | WYCIKLOWWXEONV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.15 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|