C13H13N5O3 — CID 168694718
methyl 5-oxo-1-[4-(2H-tetrazol-5-yl)phenyl]pyrrolidine-3-carboxylate (PubChem CID 168694718) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is methyl 5-oxo-1-[4-(2H-tetrazol-5-yl)phenyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl 5-oxo-1-[4-(2H-tetrazol-5-yl)phenyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168694718 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | methyl 5-oxo-1-[4-(2H-tetrazol-5-yl)phenyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(c2ccc(-c3nn[nH]n3)cc2)C1 |
| InChI | InChI=1S/C13H13N5O3/c1-21-13(20)9-6-11(19)18(7-9)10-4-2-8(3-5-10)12-14-16-17-15-12/h2-5,9H,6-7H2,1H3,(H,14,15,16,17) |
| InChIKey | CTLNZAIYLVSXIT-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |