C12H11ClN2O5 — CID 168694941
6-chloro-2-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)pyridine-3-carboxylic acid (PubChem CID 168694941) has the molecular formula C12H11ClN2O5 and a molecular weight of 298.68 g/mol. Its IUPAC name is 6-chloro-2-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 168694941 |
| Molecular Formula | C12H11ClN2O5 |
| Molecular Weight | 298.68 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 6-chloro-2-(4-methoxycarbonyl-2-oxopyrrolidin-1-yl)pyridine-3-carboxylic acid |
| SMILES | COC(=O)C1CC(=O)N(c2nc(Cl)ccc2C(=O)O)C1 |
| InChI | InChI=1S/C12H11ClN2O5/c1-20-12(19)6-4-9(16)15(5-6)10-7(11(17)18)2-3-8(13)14-10/h2-3,6H,4-5H2,1H3,(H,17,18) |
| InChIKey | ZKFDWQHMARULKG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.68 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|