C12H11N3O3 — CID 168694996
methyl 1-(3-cyano-2-pyridinyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 168694996) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is methyl 1-(3-cyano-2-pyridinyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(3-cyano-2-pyridinyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168694996 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | methyl 1-(3-cyano-2-pyridinyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(c2ncccc2C#N)C1 |
| InChI | InChI=1S/C12H11N3O3/c1-18-12(17)9-5-10(16)15(7-9)11-8(6-13)3-2-4-14-11/h2-4,9H,5,7H2,1H3 |
| InChIKey | ZWXLHMPBHZIURE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |