C12H11F3N2O3 — CID 168695126
methyl 5-oxo-1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxylate (PubChem CID 168695126) has the molecular formula C12H11F3N2O3 and a molecular weight of 288.23 g/mol. Its IUPAC name is methyl 5-oxo-1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl 5-oxo-1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168695126 |
| Molecular Formula | C12H11F3N2O3 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | methyl 5-oxo-1-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(c2cncc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C12H11F3N2O3/c1-20-11(19)7-2-10(18)17(6-7)9-3-8(4-16-5-9)12(13,14)15/h3-5,7H,2,6H2,1H3 |
| InChIKey | JSMJWCCIBYFHSL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |