C12H15N3O2 — CID 168696816
1-(3,5-dimethyl-2-pyridinyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 168696816) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 1-(3,5-dimethyl-2-pyridinyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3,5-dimethyl-2-pyridinyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168696816 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-(3,5-dimethyl-2-pyridinyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1cnc(N2CC(C(N)=O)CC2=O)c(C)c1 |
| InChI | InChI=1S/C12H15N3O2/c1-7-3-8(2)12(14-5-7)15-6-9(11(13)17)4-10(15)16/h3,5,9H,4,6H2,1-2H3,(H2,13,17) |
| InChIKey | YCFOAWANBLHJKI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |