About [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-(diethylsulfamoyl)benzoate
[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-(diethylsulfamoyl)benzoate (PubChem CID 16869751) has the molecular formula C21H21FN2O5S
and a molecular weight of 432.47 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-(diethylsulfamoyl)benzoate.
Molecular Properties
| Compound Name | [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-(diethylsulfamoyl)benzoate |
| PubChem CID | 16869751 |
| Molecular Formula | C21H21FN2O5S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)OCc2cc(-c3ccc(F)cc3)on2)cc1 |
| InChI | InChI=1S/C21H21FN2O5S/c1-3-24(4-2)30(26,27)19-11-7-16(8-12-19)21(25)28-14-18-13-20(29-23-18)15-5-9-17(22)10-6-15/h5-13H,3-4,14H2,1-2H3 |
| InChIKey | QMQZIDGRXKULDR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-(diethylsulfamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-(diethylsulfamoyl)benzoate?
The IUPAC name of [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-(diethylsulfamoyl)benzoate (CID 16869751) is [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-(diethylsulfamoyl)benzoate.
What is the SMILES notation for [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-(diethylsulfamoyl)benzoate?
The canonical SMILES for [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-(diethylsulfamoyl)benzoate is CCN(CC)S(=O)(=O)c1ccc(C(=O)OCc2cc(-c3ccc(F)cc3)on2)cc1.
What is the InChIKey of [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-(diethylsulfamoyl)benzoate?
The InChIKey is QMQZIDGRXKULDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21FN2O5S/c1-3-24(4-2)30(26,27)19-11-7-16(8-12-19)21(25)28-14-18-13-20(29-23-18)15-5-9-17(22)10-6-15/h5-13H,3-4,14H2,1-2H3.
What are the key properties of [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-(diethylsulfamoyl)benzoate?
[5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-(diethylsulfamoyl)benzoate has a molecular weight of 432.47 g/mol, XLogP of 3.87, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-fluorophenyl)-1,2-oxazol-3-yl]methyl 4-(diethylsulfamoyl)benzoate is sourced from PubChem (CID 16869751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).