About 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile
4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile (PubChem CID 168700407) has the molecular formula C11H9Cl2N3O
and a molecular weight of 270.12 g/mol. Its IUPAC name is 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile.
Molecular Properties
| Compound Name | 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile |
| PubChem CID | 168700407 |
| Molecular Formula | C11H9Cl2N3O |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)c(N2CC(N)CC2=O)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl2N3O/c12-8-1-6(4-14)2-9(13)11(8)16-5-7(15)3-10(16)17/h1-2,7H,3,5,15H2 |
| InChIKey | QDQCEOBWORWEJA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile?
The IUPAC name of 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile (CID 168700407) is 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile.
What is the SMILES notation for 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile?
The canonical SMILES for 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile is N#Cc1cc(Cl)c(N2CC(N)CC2=O)c(Cl)c1.
What is the InChIKey of 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile?
The InChIKey is QDQCEOBWORWEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2N3O/c12-8-1-6(4-14)2-9(13)11(8)16-5-7(15)3-10(16)17/h1-2,7H,3,5,15H2.
What are the key properties of 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile?
4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile has a molecular weight of 270.12 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile is sourced from PubChem (CID 168700407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).