C11H9Cl2N3O — CID 168700407
4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile (PubChem CID 168700407) has the molecular formula C11H9Cl2N3O and a molecular weight of 270.12 g/mol. Its IUPAC name is 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile.
| Compound Name | 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile |
|---|---|
| PubChem CID | 168700407 |
| Molecular Formula | C11H9Cl2N3O |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 4-(4-amino-2-oxopyrrolidin-1-yl)-3,5-dichlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)c(N2CC(N)CC2=O)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl2N3O/c12-8-1-6(4-14)2-9(13)11(8)16-5-7(15)3-10(16)17/h1-2,7H,3,5,15H2 |
| InChIKey | QDQCEOBWORWEJA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |