C13H18N4O2 — CID 168700683
4-amino-1-(5-morpholin-4-yl-2-pyridinyl)pyrrolidin-2-one (PubChem CID 168700683) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-amino-1-(5-morpholin-4-yl-2-pyridinyl)pyrrolidin-2-one.
| Compound Name | 4-amino-1-(5-morpholin-4-yl-2-pyridinyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168700683 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 4-amino-1-(5-morpholin-4-yl-2-pyridinyl)pyrrolidin-2-one |
| SMILES | NC1CC(=O)N(c2ccc(N3CCOCC3)cn2)C1 |
| InChI | InChI=1S/C13H18N4O2/c14-10-7-13(18)17(9-10)12-2-1-11(8-15-12)16-3-5-19-6-4-16/h1-2,8,10H,3-7,9,14H2 |
| InChIKey | MRHHQJWAOHPTDH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |