C11H12FNO3 — CID 168702370
1-(2-fluoro-6-methoxyphenyl)-4-hydroxypyrrolidin-2-one (PubChem CID 168702370) has the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. Its IUPAC name is 1-(2-fluoro-6-methoxyphenyl)-4-hydroxypyrrolidin-2-one.
| Compound Name | 1-(2-fluoro-6-methoxyphenyl)-4-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 168702370 |
| Molecular Formula | C11H12FNO3 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 1-(2-fluoro-6-methoxyphenyl)-4-hydroxypyrrolidin-2-one |
| SMILES | COc1cccc(F)c1N1CC(O)CC1=O |
| InChI | InChI=1S/C11H12FNO3/c1-16-9-4-2-3-8(12)11(9)13-6-7(14)5-10(13)15/h2-4,7,14H,5-6H2,1H3 |
| InChIKey | YIEDHFFDEMCBQA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |