About 1-(5-amino-2-methyl-1,2,4-triazol-3-yl)-4-hydroxypyrrolidin-2-one
1-(5-amino-2-methyl-1,2,4-triazol-3-yl)-4-hydroxypyrrolidin-2-one (PubChem CID 168702806) has the molecular formula C7H11N5O2
and a molecular weight of 197.20 g/mol. Its IUPAC name is 1-(5-amino-2-methyl-1,2,4-triazol-3-yl)-4-hydroxypyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-(5-amino-2-methyl-1,2,4-triazol-3-yl)-4-hydroxypyrrolidin-2-one |
| PubChem CID | 168702806 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 1-(5-amino-2-methyl-1,2,4-triazol-3-yl)-4-hydroxypyrrolidin-2-one |
| SMILES | Cn1nc(N)nc1N1CC(O)CC1=O |
| InChI | InChI=1S/C7H11N5O2/c1-11-7(9-6(8)10-11)12-3-4(13)2-5(12)14/h4,13H,2-3H2,1H3,(H2,8,10) |
| InChIKey | IICPARKWGVDYFM-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5-amino-2-methyl-1,2,4-triazol-3-yl)-4-hydroxypyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-2-methyl-1,2,4-triazol-3-yl)-4-hydroxypyrrolidin-2-one?
The IUPAC name of 1-(5-amino-2-methyl-1,2,4-triazol-3-yl)-4-hydroxypyrrolidin-2-one (CID 168702806) is 1-(5-amino-2-methyl-1,2,4-triazol-3-yl)-4-hydroxypyrrolidin-2-one.
What is the SMILES notation for 1-(5-amino-2-methyl-1,2,4-triazol-3-yl)-4-hydroxypyrrolidin-2-one?
The canonical SMILES for 1-(5-amino-2-methyl-1,2,4-triazol-3-yl)-4-hydroxypyrrolidin-2-one is Cn1nc(N)nc1N1CC(O)CC1=O.
What is the InChIKey of 1-(5-amino-2-methyl-1,2,4-triazol-3-yl)-4-hydroxypyrrolidin-2-one?
The InChIKey is IICPARKWGVDYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N5O2/c1-11-7(9-6(8)10-11)12-3-4(13)2-5(12)14/h4,13H,2-3H2,1H3,(H2,8,10).
What are the key properties of 1-(5-amino-2-methyl-1,2,4-triazol-3-yl)-4-hydroxypyrrolidin-2-one?
1-(5-amino-2-methyl-1,2,4-triazol-3-yl)-4-hydroxypyrrolidin-2-one has a molecular weight of 197.20 g/mol, XLogP of -1.51, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-2-methyl-1,2,4-triazol-3-yl)-4-hydroxypyrrolidin-2-one is sourced from PubChem (CID 168702806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).