About 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-hydroxypyrrolidin-2-one
1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-hydroxypyrrolidin-2-one (PubChem CID 168704051) has the molecular formula C7H8ClN5O2
and a molecular weight of 229.63 g/mol. Its IUPAC name is 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-hydroxypyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-hydroxypyrrolidin-2-one |
| PubChem CID | 168704051 |
| Molecular Formula | C7H8ClN5O2 |
| Molecular Weight | 229.63 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-hydroxypyrrolidin-2-one |
| SMILES | Nc1nc(Cl)nc(N2CC(O)CC2=O)n1 |
| InChI | InChI=1S/C7H8ClN5O2/c8-5-10-6(9)12-7(11-5)13-2-3(14)1-4(13)15/h3,14H,1-2H2,(H2,9,10,11,12) |
| InChIKey | UGGBGPLEVHNSBU-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.63 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-hydroxypyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-hydroxypyrrolidin-2-one?
The IUPAC name of 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-hydroxypyrrolidin-2-one (CID 168704051) is 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-hydroxypyrrolidin-2-one.
What is the SMILES notation for 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-hydroxypyrrolidin-2-one?
The canonical SMILES for 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-hydroxypyrrolidin-2-one is Nc1nc(Cl)nc(N2CC(O)CC2=O)n1.
What is the InChIKey of 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-hydroxypyrrolidin-2-one?
The InChIKey is UGGBGPLEVHNSBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN5O2/c8-5-10-6(9)12-7(11-5)13-2-3(14)1-4(13)15/h3,14H,1-2H2,(H2,9,10,11,12).
What are the key properties of 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-hydroxypyrrolidin-2-one?
1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-hydroxypyrrolidin-2-one has a molecular weight of 229.63 g/mol, XLogP of -0.80, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-6-chloro-1,3,5-triazin-2-yl)-4-hydroxypyrrolidin-2-one is sourced from PubChem (CID 168704051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).