About 4-hydroxy-1-(1,3,5-triazin-2-yl)pyrrolidin-2-one
4-hydroxy-1-(1,3,5-triazin-2-yl)pyrrolidin-2-one (PubChem CID 168704143) has the molecular formula C7H8N4O2
and a molecular weight of 180.17 g/mol. Its IUPAC name is 4-hydroxy-1-(1,3,5-triazin-2-yl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-1-(1,3,5-triazin-2-yl)pyrrolidin-2-one |
| PubChem CID | 168704143 |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 4-hydroxy-1-(1,3,5-triazin-2-yl)pyrrolidin-2-one |
| SMILES | O=C1CC(O)CN1c1ncncn1 |
| InChI | InChI=1S/C7H8N4O2/c12-5-1-6(13)11(2-5)7-9-3-8-4-10-7/h3-5,12H,1-2H2 |
| InChIKey | NWBNXNHYPOXZBL-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-hydroxy-1-(1,3,5-triazin-2-yl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1-(1,3,5-triazin-2-yl)pyrrolidin-2-one?
The IUPAC name of 4-hydroxy-1-(1,3,5-triazin-2-yl)pyrrolidin-2-one (CID 168704143) is 4-hydroxy-1-(1,3,5-triazin-2-yl)pyrrolidin-2-one.
What is the SMILES notation for 4-hydroxy-1-(1,3,5-triazin-2-yl)pyrrolidin-2-one?
The canonical SMILES for 4-hydroxy-1-(1,3,5-triazin-2-yl)pyrrolidin-2-one is O=C1CC(O)CN1c1ncncn1.
What is the InChIKey of 4-hydroxy-1-(1,3,5-triazin-2-yl)pyrrolidin-2-one?
The InChIKey is NWBNXNHYPOXZBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O2/c12-5-1-6(13)11(2-5)7-9-3-8-4-10-7/h3-5,12H,1-2H2.
What are the key properties of 4-hydroxy-1-(1,3,5-triazin-2-yl)pyrrolidin-2-one?
4-hydroxy-1-(1,3,5-triazin-2-yl)pyrrolidin-2-one has a molecular weight of 180.17 g/mol, XLogP of -1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1-(1,3,5-triazin-2-yl)pyrrolidin-2-one is sourced from PubChem (CID 168704143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).