About S-[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl] ethanethioate
S-[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168704716) has the molecular formula C13H21NO5S
and a molecular weight of 303.38 g/mol. Its IUPAC name is S-[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl] ethanethioate.
Molecular Properties
| Compound Name | S-[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl] ethanethioate |
| PubChem CID | 168704716 |
| Molecular Formula | C13H21NO5S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | S-[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(C2(CO)COC(C)(C)OC2)C1 |
| InChI | InChI=1S/C13H21NO5S/c1-9(16)20-10-4-11(17)14(5-10)13(6-15)7-18-12(2,3)19-8-13/h10,15H,4-8H2,1-3H3 |
| InChIKey | VHEPCZRSKYHLHN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl] ethanethioate?
The IUPAC name of S-[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl] ethanethioate (CID 168704716) is S-[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl] ethanethioate.
What is the SMILES notation for S-[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl] ethanethioate?
The canonical SMILES for S-[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl] ethanethioate is CC(=O)SC1CC(=O)N(C2(CO)COC(C)(C)OC2)C1.
What is the InChIKey of S-[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl] ethanethioate?
The InChIKey is VHEPCZRSKYHLHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO5S/c1-9(16)20-10-4-11(17)14(5-10)13(6-15)7-18-12(2,3)19-8-13/h10,15H,4-8H2,1-3H3.
What are the key properties of S-[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl] ethanethioate?
S-[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl] ethanethioate has a molecular weight of 303.38 g/mol, XLogP of 0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-[1-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-5-oxopyrrolidin-3-yl] ethanethioate is sourced from PubChem (CID 168704716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).