C14H16ClNO3S — CID 168705462
S-[1-(5-chloro-2-methoxy-4-methylphenyl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168705462) has the molecular formula C14H16ClNO3S and a molecular weight of 313.81 g/mol. Its IUPAC name is S-[1-(5-chloro-2-methoxy-4-methylphenyl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(5-chloro-2-methoxy-4-methylphenyl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168705462 |
| Molecular Formula | C14H16ClNO3S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | S-[1-(5-chloro-2-methoxy-4-methylphenyl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | COc1cc(C)c(Cl)cc1N1CC(SC(C)=O)CC1=O |
| InChI | InChI=1S/C14H16ClNO3S/c1-8-4-13(19-3)12(6-11(8)15)16-7-10(5-14(16)18)20-9(2)17/h4,6,10H,5,7H2,1-3H3 |
| InChIKey | HZRQTPFTCKYJPO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|