C14H16N2O4S — CID 168705730
S-[1-(2,6-dimethyl-4-nitrophenyl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168705730) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is S-[1-(2,6-dimethyl-4-nitrophenyl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(2,6-dimethyl-4-nitrophenyl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168705730 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | S-[1-(2,6-dimethyl-4-nitrophenyl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2c(C)cc([N+](=O)[O-])cc2C)C1 |
| InChI | InChI=1S/C14H16N2O4S/c1-8-4-11(16(19)20)5-9(2)14(8)15-7-12(6-13(15)18)21-10(3)17/h4-5,12H,6-7H2,1-3H3 |
| InChIKey | GSNCLRVHSTUAMG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|