C12H10N4O2S — CID 168705888
S-[5-oxo-1-(1,1,3-tricyanoprop-1-en-2-yl)pyrrolidin-3-yl] ethanethioate (PubChem CID 168705888) has the molecular formula C12H10N4O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is S-[5-oxo-1-(1,1,3-tricyanoprop-1-en-2-yl)pyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[5-oxo-1-(1,1,3-tricyanoprop-1-en-2-yl)pyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168705888 |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | S-[5-oxo-1-(1,1,3-tricyanoprop-1-en-2-yl)pyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(C(CC#N)=C(C#N)C#N)C1 |
| InChI | InChI=1S/C12H10N4O2S/c1-8(17)19-10-4-12(18)16(7-10)11(2-3-13)9(5-14)6-15/h10H,2,4,7H2,1H3 |
| InChIKey | JSXQYVQBNAZWNN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 108.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|