C12H11Br2NO2S — CID 168706542
S-[1-(3,4-dibromophenyl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168706542) has the molecular formula C12H11Br2NO2S and a molecular weight of 393.10 g/mol. Its IUPAC name is S-[1-(3,4-dibromophenyl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(3,4-dibromophenyl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168706542 |
| Molecular Formula | C12H11Br2NO2S |
| Molecular Weight | 393.10 g/mol |
| Exact Mass | 390.89 |
| IUPAC Name | S-[1-(3,4-dibromophenyl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2ccc(Br)c(Br)c2)C1 |
| InChI | InChI=1S/C12H11Br2NO2S/c1-7(16)18-9-5-12(17)15(6-9)8-2-3-10(13)11(14)4-8/h2-4,9H,5-6H2,1H3 |
| InChIKey | JOCAILYAZPVVKH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.10 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|