About 1-(2,2-dimethyl-1,3-dioxan-5-yl)-4-sulfanylpyrrolidin-2-one
1-(2,2-dimethyl-1,3-dioxan-5-yl)-4-sulfanylpyrrolidin-2-one (PubChem CID 168708044) has the molecular formula C10H17NO3S
and a molecular weight of 231.32 g/mol. Its IUPAC name is 1-(2,2-dimethyl-1,3-dioxan-5-yl)-4-sulfanylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-(2,2-dimethyl-1,3-dioxan-5-yl)-4-sulfanylpyrrolidin-2-one |
| PubChem CID | 168708044 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 1-(2,2-dimethyl-1,3-dioxan-5-yl)-4-sulfanylpyrrolidin-2-one |
| SMILES | CC1(C)OCC(N2CC(S)CC2=O)CO1 |
| InChI | InChI=1S/C10H17NO3S/c1-10(2)13-5-7(6-14-10)11-4-8(15)3-9(11)12/h7-8,15H,3-6H2,1-2H3 |
| InChIKey | COKLGQMVLXBMSH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethyl-1,3-dioxan-5-yl)-4-sulfanylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethyl-1,3-dioxan-5-yl)-4-sulfanylpyrrolidin-2-one?
The IUPAC name of 1-(2,2-dimethyl-1,3-dioxan-5-yl)-4-sulfanylpyrrolidin-2-one (CID 168708044) is 1-(2,2-dimethyl-1,3-dioxan-5-yl)-4-sulfanylpyrrolidin-2-one.
What is the SMILES notation for 1-(2,2-dimethyl-1,3-dioxan-5-yl)-4-sulfanylpyrrolidin-2-one?
The canonical SMILES for 1-(2,2-dimethyl-1,3-dioxan-5-yl)-4-sulfanylpyrrolidin-2-one is CC1(C)OCC(N2CC(S)CC2=O)CO1.
What is the InChIKey of 1-(2,2-dimethyl-1,3-dioxan-5-yl)-4-sulfanylpyrrolidin-2-one?
The InChIKey is COKLGQMVLXBMSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3S/c1-10(2)13-5-7(6-14-10)11-4-8(15)3-9(11)12/h7-8,15H,3-6H2,1-2H3.
What are the key properties of 1-(2,2-dimethyl-1,3-dioxan-5-yl)-4-sulfanylpyrrolidin-2-one?
1-(2,2-dimethyl-1,3-dioxan-5-yl)-4-sulfanylpyrrolidin-2-one has a molecular weight of 231.32 g/mol, XLogP of 0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethyl-1,3-dioxan-5-yl)-4-sulfanylpyrrolidin-2-one is sourced from PubChem (CID 168708044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).