C16H23NOS — CID 168708084
1-[2,6-di(propan-2-yl)phenyl]-4-sulfanylpyrrolidin-2-one (PubChem CID 168708084) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168708084 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-4-sulfanylpyrrolidin-2-one |
| SMILES | CC(C)c1cccc(C(C)C)c1N1CC(S)CC1=O |
| InChI | InChI=1S/C16H23NOS/c1-10(2)13-6-5-7-14(11(3)4)16(13)17-9-12(19)8-15(17)18/h5-7,10-12,19H,8-9H2,1-4H3 |
| InChIKey | WBECKFSDIAISQK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|