C9H11N3O2S — CID 168709050
4-methyl-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)-1H-pyrimidin-6-one (PubChem CID 168709050) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is 4-methyl-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)-1H-pyrimidin-6-one.
| Compound Name | 4-methyl-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 168709050 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 4-methyl-2-(2-oxo-4-sulfanylpyrrolidin-1-yl)-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(N2CC(S)CC2=O)n1 |
| InChI | InChI=1S/C9H11N3O2S/c1-5-2-7(13)11-9(10-5)12-4-6(15)3-8(12)14/h2,6,15H,3-4H2,1H3,(H,10,11,13) |
| InChIKey | CCIHRFUGIHTJPQ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|