About 2-methoxynaphthalene-1,4-dione
2-methoxynaphthalene-1,4-dione (PubChem CID 16871) has the molecular formula C11H8O3
and a molecular weight of 188.18 g/mol. Its IUPAC name is 2-methoxynaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2-methoxynaphthalene-1,4-dione |
| PubChem CID | 16871 |
| Molecular Formula | C11H8O3 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 2-methoxynaphthalene-1,4-dione |
| SMILES | COC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H8O3/c1-14-10-6-9(12)7-4-2-3-5-8(7)11(10)13/h2-6H,1H3 |
| InChIKey | OBGBGHKYJAOXRR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxynaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxynaphthalene-1,4-dione?
The IUPAC name of 2-methoxynaphthalene-1,4-dione (CID 16871) is 2-methoxynaphthalene-1,4-dione.
What is the SMILES notation for 2-methoxynaphthalene-1,4-dione?
The canonical SMILES for 2-methoxynaphthalene-1,4-dione is COC1=CC(=O)c2ccccc2C1=O.
What is the InChIKey of 2-methoxynaphthalene-1,4-dione?
The InChIKey is OBGBGHKYJAOXRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O3/c1-14-10-6-9(12)7-4-2-3-5-8(7)11(10)13/h2-6H,1H3.
What are the key properties of 2-methoxynaphthalene-1,4-dione?
2-methoxynaphthalene-1,4-dione has a molecular weight of 188.18 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxynaphthalene-1,4-dione is sourced from PubChem (CID 16871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).