C10H12N2O2S2 — CID 168710696
1-(6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-yl)-4-sulfanylpyrrolidin-2-one (PubChem CID 168710696) has the molecular formula C10H12N2O2S2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-(6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-yl)-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-(6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-yl)-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168710696 |
| Molecular Formula | C10H12N2O2S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 1-(6,7-dihydro-4H-pyrano[4,3-d][1,3]thiazol-2-yl)-4-sulfanylpyrrolidin-2-one |
| SMILES | O=C1CC(S)CN1c1nc2c(s1)COCC2 |
| InChI | InChI=1S/C10H12N2O2S2/c13-9-3-6(15)4-12(9)10-11-7-1-2-14-5-8(7)16-10/h6,15H,1-5H2 |
| InChIKey | AFBSZWYUFSNQRE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 42.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|