C11H10N4O2S — CID 168710813
1-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)-4-sulfanylpyrrolidin-2-one (PubChem CID 168710813) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is 1-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168710813 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 1-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)-4-sulfanylpyrrolidin-2-one |
| SMILES | O=C1CC(S)CN1c1nnc(-c2cccnc2)o1 |
| InChI | InChI=1S/C11H10N4O2S/c16-9-4-8(18)6-15(9)11-14-13-10(17-11)7-2-1-3-12-5-7/h1-3,5,8,18H,4,6H2 |
| InChIKey | SUYQJJIBSRUAPU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 72.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|