C10H12ClNO4S — CID 168712116
1-[2-(furan-2-yl)ethyl]-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168712116) has the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168712116 |
| Molecular Formula | C10H12ClNO4S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | O=C1CC(S(=O)(=O)Cl)CN1CCc1ccco1 |
| InChI | InChI=1S/C10H12ClNO4S/c11-17(14,15)9-6-10(13)12(7-9)4-3-8-2-1-5-16-8/h1-2,5,9H,3-4,6-7H2 |
| InChIKey | NRKYSFRTXUJWQR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |