C14H17ClN2O4S — CID 168712858
1-(3-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168712858) has the molecular formula C14H17ClN2O4S and a molecular weight of 344.82 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-(3-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168712858 |
| Molecular Formula | C14H17ClN2O4S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 1-(3-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | O=C1CC(S(=O)(=O)Cl)CN1c1cccc(N2CCOCC2)c1 |
| InChI | InChI=1S/C14H17ClN2O4S/c15-22(19,20)13-9-14(18)17(10-13)12-3-1-2-11(8-12)16-4-6-21-7-5-16/h1-3,8,13H,4-7,9-10H2 |
| InChIKey | IIIMDFNANCSXKM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |