About 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-5-oxopyrrolidine-3-sulfonyl fluoride
1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168713037) has the molecular formula C12H21FN2O3S
and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
Molecular Properties
| Compound Name | 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| PubChem CID | 168713037 |
| Molecular Formula | C12H21FN2O3S |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | CN(C)[C@H]1CCCC[C@@H]1N1CC(S(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C12H21FN2O3S/c1-14(2)10-5-3-4-6-11(10)15-8-9(7-12(15)16)19(13,17)18/h9-11H,3-8H2,1-2H3/t9?,10-,11-/m0/s1 |
| InChIKey | HMGNVFUBLWIWCD-DVRYWGNFSA-N |
| XLogP | 0.76 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-5-oxopyrrolidine-3-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-5-oxopyrrolidine-3-sulfonyl fluoride?
The IUPAC name of 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-5-oxopyrrolidine-3-sulfonyl fluoride (CID 168713037) is 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
What is the SMILES notation for 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-5-oxopyrrolidine-3-sulfonyl fluoride?
The canonical SMILES for 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-5-oxopyrrolidine-3-sulfonyl fluoride is CN(C)[C@H]1CCCC[C@@H]1N1CC(S(=O)(=O)F)CC1=O.
What is the InChIKey of 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-5-oxopyrrolidine-3-sulfonyl fluoride?
The InChIKey is HMGNVFUBLWIWCD-DVRYWGNFSA-N. The full InChI is InChI=1S/C12H21FN2O3S/c1-14(2)10-5-3-4-6-11(10)15-8-9(7-12(15)16)19(13,17)18/h9-11H,3-8H2,1-2H3/t9?,10-,11-/m0/s1.
What are the key properties of 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-5-oxopyrrolidine-3-sulfonyl fluoride?
1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-5-oxopyrrolidine-3-sulfonyl fluoride has a molecular weight of 292.38 g/mol, XLogP of 0.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2S)-2-(dimethylamino)cyclohexyl]-5-oxopyrrolidine-3-sulfonyl fluoride is sourced from PubChem (CID 168713037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).