C13H16FNO4S — CID 168713263
1-[(1S)-1-(4-methoxyphenyl)ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168713263) has the molecular formula C13H16FNO4S and a molecular weight of 301.34 g/mol. Its IUPAC name is 1-[(1S)-1-(4-methoxyphenyl)ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[(1S)-1-(4-methoxyphenyl)ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168713263 |
| Molecular Formula | C13H16FNO4S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 1-[(1S)-1-(4-methoxyphenyl)ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | COc1ccc([C@H](C)N2CC(S(=O)(=O)F)CC2=O)cc1 |
| InChI | InChI=1S/C13H16FNO4S/c1-9(10-3-5-11(19-2)6-4-10)15-8-12(7-13(15)16)20(14,17)18/h3-6,9,12H,7-8H2,1-2H3/t9-,12?/m0/s1 |
| InChIKey | QWWFXYFCUKCCKU-QHGLUPRGSA-N |
| XLogP | 1.66 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |