About 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonyl fluoride
1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168713541) has the molecular formula C11H20FNO4S
and a molecular weight of 281.35 g/mol. Its IUPAC name is 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
Molecular Properties
| Compound Name | 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| PubChem CID | 168713541 |
| Molecular Formula | C11H20FNO4S |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | CC(C)(CO)CCCN1CC(S(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C11H20FNO4S/c1-11(2,8-14)4-3-5-13-7-9(6-10(13)15)18(12,16)17/h9,14H,3-8H2,1-2H3 |
| InChIKey | CZAXTYYHTDDCEH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The IUPAC name of 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonyl fluoride (CID 168713541) is 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
What is the SMILES notation for 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The canonical SMILES for 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonyl fluoride is CC(C)(CO)CCCN1CC(S(=O)(=O)F)CC1=O.
What is the InChIKey of 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The InChIKey is CZAXTYYHTDDCEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20FNO4S/c1-11(2,8-14)4-3-5-13-7-9(6-10(13)15)18(12,16)17/h9,14H,3-8H2,1-2H3.
What are the key properties of 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonyl fluoride?
1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonyl fluoride has a molecular weight of 281.35 g/mol, XLogP of 0.69, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonyl fluoride is sourced from PubChem (CID 168713541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).