About 1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride
1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168713552) has the molecular formula C10H16FNO5S
and a molecular weight of 281.30 g/mol. Its IUPAC name is 1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride.
Molecular Properties
| Compound Name | 1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| PubChem CID | 168713552 |
| Molecular Formula | C10H16FNO5S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | CC1(C)OCC(N2CC(S(=O)(=O)F)CC2=O)CO1 |
| InChI | InChI=1S/C10H16FNO5S/c1-10(2)16-5-7(6-17-10)12-4-8(3-9(12)13)18(11,14)15/h7-8H,3-6H2,1-2H3 |
| InChIKey | JWWJGZOMMWZKAE-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The IUPAC name of 1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride (CID 168713552) is 1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride.
What is the SMILES notation for 1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The canonical SMILES for 1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride is CC1(C)OCC(N2CC(S(=O)(=O)F)CC2=O)CO1.
What is the InChIKey of 1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The InChIKey is JWWJGZOMMWZKAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16FNO5S/c1-10(2)16-5-7(6-17-10)12-4-8(3-9(12)13)18(11,14)15/h7-8H,3-6H2,1-2H3.
What are the key properties of 1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride?
1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride has a molecular weight of 281.30 g/mol, XLogP of 0.04, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethyl-1,3-dioxan-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride is sourced from PubChem (CID 168713552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).