About 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride
1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714222) has the molecular formula C7H9FN4O3S2
and a molecular weight of 280.31 g/mol. Its IUPAC name is 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride.
Molecular Properties
| Compound Name | 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| PubChem CID | 168714222 |
| Molecular Formula | C7H9FN4O3S2 |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | CSc1n[nH]c(N2CC(S(=O)(=O)F)CC2=O)n1 |
| InChI | InChI=1S/C7H9FN4O3S2/c1-16-7-9-6(10-11-7)12-3-4(2-5(12)13)17(8,14)15/h4H,2-3H2,1H3,(H,9,10,11) |
| InChIKey | VSTVIZQHAVXXOF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The IUPAC name of 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride (CID 168714222) is 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride.
What is the SMILES notation for 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The canonical SMILES for 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride is CSc1n[nH]c(N2CC(S(=O)(=O)F)CC2=O)n1.
What is the InChIKey of 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The InChIKey is VSTVIZQHAVXXOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN4O3S2/c1-16-7-9-6(10-11-7)12-3-4(2-5(12)13)17(8,14)15/h4H,2-3H2,1H3,(H,9,10,11).
What are the key properties of 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride?
1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride has a molecular weight of 280.31 g/mol, XLogP of -0.07, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride is sourced from PubChem (CID 168714222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).