About 1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride
1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714687) has the molecular formula C9H8FN3O4S
and a molecular weight of 273.25 g/mol. Its IUPAC name is 1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride.
Molecular Properties
| Compound Name | 1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| PubChem CID | 168714687 |
| Molecular Formula | C9H8FN3O4S |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | Cc1noc(N2CC(S(=O)(=O)F)CC2=O)c1C#N |
| InChI | InChI=1S/C9H8FN3O4S/c1-5-7(3-11)9(17-12-5)13-4-6(2-8(13)14)18(10,15)16/h6H,2,4H2,1H3 |
| InChIKey | MDEXLKMTLJSPET-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 104.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The IUPAC name of 1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride (CID 168714687) is 1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride.
What is the SMILES notation for 1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The canonical SMILES for 1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride is Cc1noc(N2CC(S(=O)(=O)F)CC2=O)c1C#N.
What is the InChIKey of 1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The InChIKey is MDEXLKMTLJSPET-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FN3O4S/c1-5-7(3-11)9(17-12-5)13-4-6(2-8(13)14)18(10,15)16/h6H,2,4H2,1H3.
What are the key properties of 1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride?
1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride has a molecular weight of 273.25 g/mol, XLogP of 0.26, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-cyano-3-methyl-1,2-oxazol-5-yl)-5-oxopyrrolidine-3-sulfonyl fluoride is sourced from PubChem (CID 168714687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).