C8H13N3O7S2 — CID 168716369
(2S,3S)-2-methyl-4-oxo-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)azetidine-1-sulfonic acid (PubChem CID 168716369) has the molecular formula C8H13N3O7S2 and a molecular weight of 327.34 g/mol. Its IUPAC name is (2S,3S)-2-methyl-4-oxo-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)azetidine-1-sulfonic acid.
| Compound Name | (2S,3S)-2-methyl-4-oxo-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)azetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 168716369 |
| Molecular Formula | C8H13N3O7S2 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | (2S,3S)-2-methyl-4-oxo-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)azetidine-1-sulfonic acid |
| SMILES | C[C@H]1[C@H](N2CC(S(N)(=O)=O)CC2=O)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C8H13N3O7S2/c1-4-7(8(13)11(4)20(16,17)18)10-3-5(2-6(10)12)19(9,14)15/h4-5,7H,2-3H2,1H3,(H2,9,14,15)(H,16,17,18)/t4-,5?,7-/m0/s1 |
| InChIKey | ZAPXVFPHNXHNRB-VZWBMFKNSA-N |
| XLogP | -2.72 |
| TPSA | 155.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|