About 1-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-5-oxopyrrolidine-3-sulfonamide
1-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168716427) has the molecular formula C10H20N2O4S
and a molecular weight of 264.35 g/mol. Its IUPAC name is 1-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-5-oxopyrrolidine-3-sulfonamide.
Molecular Properties
| Compound Name | 1-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-5-oxopyrrolidine-3-sulfonamide |
| PubChem CID | 168716427 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-5-oxopyrrolidine-3-sulfonamide |
| SMILES | CC(C)(C)[C@@H](CO)N1CC(S(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C10H20N2O4S/c1-10(2,3)8(6-13)12-5-7(4-9(12)14)17(11,15)16/h7-8,13H,4-6H2,1-3H3,(H2,11,15,16)/t7?,8-/m1/s1 |
| InChIKey | PAGJIYRDCZLVQV-BRFYHDHCSA-N |
| XLogP | -0.72 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-5-oxopyrrolidine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-5-oxopyrrolidine-3-sulfonamide?
The IUPAC name of 1-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-5-oxopyrrolidine-3-sulfonamide (CID 168716427) is 1-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-5-oxopyrrolidine-3-sulfonamide.
What is the SMILES notation for 1-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-5-oxopyrrolidine-3-sulfonamide?
The canonical SMILES for 1-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-5-oxopyrrolidine-3-sulfonamide is CC(C)(C)[C@@H](CO)N1CC(S(N)(=O)=O)CC1=O.
What is the InChIKey of 1-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-5-oxopyrrolidine-3-sulfonamide?
The InChIKey is PAGJIYRDCZLVQV-BRFYHDHCSA-N. The full InChI is InChI=1S/C10H20N2O4S/c1-10(2,3)8(6-13)12-5-7(4-9(12)14)17(11,15)16/h7-8,13H,4-6H2,1-3H3,(H2,11,15,16)/t7?,8-/m1/s1.
What are the key properties of 1-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-5-oxopyrrolidine-3-sulfonamide?
1-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-5-oxopyrrolidine-3-sulfonamide has a molecular weight of 264.35 g/mol, XLogP of -0.72, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-5-oxopyrrolidine-3-sulfonamide is sourced from PubChem (CID 168716427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).