About 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide
1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168716869) has the molecular formula C11H22N2O4S
and a molecular weight of 278.37 g/mol. Its IUPAC name is 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide.
Molecular Properties
| Compound Name | 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide |
| PubChem CID | 168716869 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | CC(C)(CO)CCCN1CC(S(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C11H22N2O4S/c1-11(2,8-14)4-3-5-13-7-9(6-10(13)15)18(12,16)17/h9,14H,3-8H2,1-2H3,(H2,12,16,17) |
| InChIKey | DZLPYWCBTIPFBU-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide?
The IUPAC name of 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide (CID 168716869) is 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide.
What is the SMILES notation for 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide?
The canonical SMILES for 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide is CC(C)(CO)CCCN1CC(S(N)(=O)=O)CC1=O.
What is the InChIKey of 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide?
The InChIKey is DZLPYWCBTIPFBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O4S/c1-11(2,8-14)4-3-5-13-7-9(6-10(13)15)18(12,16)17/h9,14H,3-8H2,1-2H3,(H2,12,16,17).
What are the key properties of 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide?
1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide has a molecular weight of 278.37 g/mol, XLogP of -0.33, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-hydroxy-4,4-dimethylpentyl)-5-oxopyrrolidine-3-sulfonamide is sourced from PubChem (CID 168716869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).