C10H13N5O4S — CID 168719049
1-[4-cyano-1-(2-hydroxyethyl)pyrazol-5-yl]-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168719049) has the molecular formula C10H13N5O4S and a molecular weight of 299.31 g/mol. Its IUPAC name is 1-[4-cyano-1-(2-hydroxyethyl)pyrazol-5-yl]-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-[4-cyano-1-(2-hydroxyethyl)pyrazol-5-yl]-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168719049 |
| Molecular Formula | C10H13N5O4S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 1-[4-cyano-1-(2-hydroxyethyl)pyrazol-5-yl]-5-oxopyrrolidine-3-sulfonamide |
| SMILES | N#Cc1cnn(CCO)c1N1CC(S(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C10H13N5O4S/c11-4-7-5-13-15(1-2-16)10(7)14-6-8(3-9(14)17)20(12,18)19/h5,8,16H,1-3,6H2,(H2,12,18,19) |
| InChIKey | VZUBRTJHQASNIZ-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 142.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |