C12H17ClFN — CID 168719722
cis-(1R,3S)-3-(4-fluorophenyl)cyclohexan-1-amine;hydrochloride (PubChem CID 168719722) has the molecular formula C12H17ClFN and a molecular weight of 229.73 g/mol. Its IUPAC name is cis-(1R,3S)-3-(4-fluorophenyl)cyclohexan-1-amine;hydrochloride.
| Compound Name | cis-(1R,3S)-3-(4-fluorophenyl)cyclohexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 168719722 |
| Molecular Formula | C12H17ClFN |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | cis-(1R,3S)-3-(4-fluorophenyl)cyclohexan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CCC[C@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C12H16FN.ClH/c13-11-6-4-9(5-7-11)10-2-1-3-12(14)8-10;/h4-7,10,12H,1-3,8,14H2;1H/t10-,12+;/m0./s1 |
| InChIKey | PUASVLGQMFLAQC-XOZOLZJESA-N |
| XLogP | 3.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |