About 6-octylimino-1,3-diazinane-2,4-dione
6-octylimino-1,3-diazinane-2,4-dione (PubChem CID 168719775) has the molecular formula C12H21N3O2
and a molecular weight of 239.32 g/mol. Its IUPAC name is 6-octylimino-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 6-octylimino-1,3-diazinane-2,4-dione |
| PubChem CID | 168719775 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 6-octylimino-1,3-diazinane-2,4-dione |
| SMILES | CCCCCCCC/N=C1\CC(=O)NC(=O)N1 |
| InChI | InChI=1S/C12H21N3O2/c1-2-3-4-5-6-7-8-13-10-9-11(16)15-12(17)14-10/h2-9H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | PNPWQWFLXGGIRQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-octylimino-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-octylimino-1,3-diazinane-2,4-dione?
The IUPAC name of 6-octylimino-1,3-diazinane-2,4-dione (CID 168719775) is 6-octylimino-1,3-diazinane-2,4-dione.
What is the SMILES notation for 6-octylimino-1,3-diazinane-2,4-dione?
The canonical SMILES for 6-octylimino-1,3-diazinane-2,4-dione is CCCCCCCC/N=C1\CC(=O)NC(=O)N1.
What is the InChIKey of 6-octylimino-1,3-diazinane-2,4-dione?
The InChIKey is PNPWQWFLXGGIRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2/c1-2-3-4-5-6-7-8-13-10-9-11(16)15-12(17)14-10/h2-9H2,1H3,(H2,13,14,15,16,17).
What are the key properties of 6-octylimino-1,3-diazinane-2,4-dione?
6-octylimino-1,3-diazinane-2,4-dione has a molecular weight of 239.32 g/mol, XLogP of 1.97, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-octylimino-1,3-diazinane-2,4-dione is sourced from PubChem (CID 168719775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).