C7H15BNO6- — CID 168719776
3-amino-3-(hydroxymethyl)-1,5,7,11-tetraoxa-6-boranuidaspiro[5.5]undecan-9-ol (PubChem CID 168719776) has the molecular formula C7H15BNO6- and a molecular weight of 220.01 g/mol. Its IUPAC name is 3-amino-3-(hydroxymethyl)-1,5,7,11-tetraoxa-6-boranuidaspiro[5.5]undecan-9-ol.
| Compound Name | 3-amino-3-(hydroxymethyl)-1,5,7,11-tetraoxa-6-boranuidaspiro[5.5]undecan-9-ol |
|---|---|
| PubChem CID | 168719776 |
| Molecular Formula | C7H15BNO6- |
| Molecular Weight | 220.01 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3-amino-3-(hydroxymethyl)-1,5,7,11-tetraoxa-6-boranuidaspiro[5.5]undecan-9-ol |
| SMILES | NC1(CO)CO[B-]2(OCC(O)CO2)OC1 |
| InChI | InChI=1S/C7H15BNO6/c9-7(3-10)4-14-8(15-5-7)12-1-6(11)2-13-8/h6,10-11H,1-5,9H2/q-1 |
| InChIKey | NORKYMYNBIQBFM-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.01 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|